C5H12N2O2 — CID 138612980
3-hydroxy-N,N'-dimethylpropanehydrazide (PubChem CID 138612980) has the molecular formula C5H12N2O2 and a molecular weight of 132.16 g/mol. Its IUPAC name is 3-hydroxy-N,N'-dimethylpropanehydrazide.
| Compound Name | 3-hydroxy-N,N'-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 138612980 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 3-hydroxy-N,N'-dimethylpropanehydrazide |
| SMILES | CNN(C)C(=O)CCO |
| InChI | InChI=1S/C5H12N2O2/c1-6-7(2)5(9)3-4-8/h6,8H,3-4H2,1-2H3 |
| InChIKey | QLEZHAVNBFLVOD-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|