C6H10N2O2 — CID 138706048
(Z)-N,N'-dimethyl-4-oxobut-2-enehydrazide (PubChem CID 138706048) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is (Z)-N,N'-dimethyl-4-oxobut-2-enehydrazide.
| Compound Name | (Z)-N,N'-dimethyl-4-oxobut-2-enehydrazide |
|---|---|
| PubChem CID | 138706048 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | (Z)-N,N'-dimethyl-4-oxobut-2-enehydrazide |
| SMILES | CNN(C)C(=O)/C=C\C=O |
| InChI | InChI=1S/C6H10N2O2/c1-7-8(2)6(10)4-3-5-9/h3-5,7H,1-2H3/b4-3- |
| InChIKey | CEOUSIAFQVBNDC-ARJAWSKDSA-N |
| XLogP | -0.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|