C13H13F2NO2 — CID 138459893
(Z)-N-[(3,5-difluoro-4-methylphenyl)methyl]-N-methyl-4-oxobut-2-enamide (PubChem CID 138459893) has the molecular formula C13H13F2NO2 and a molecular weight of 253.25 g/mol. Its IUPAC name is (Z)-N-[(3,5-difluoro-4-methylphenyl)methyl]-N-methyl-4-oxobut-2-enamide.
| Compound Name | (Z)-N-[(3,5-difluoro-4-methylphenyl)methyl]-N-methyl-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 138459893 |
| Molecular Formula | C13H13F2NO2 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | (Z)-N-[(3,5-difluoro-4-methylphenyl)methyl]-N-methyl-4-oxobut-2-enamide |
| SMILES | Cc1c(F)cc(CN(C)C(=O)/C=C\C=O)cc1F |
| InChI | InChI=1S/C13H13F2NO2/c1-9-11(14)6-10(7-12(9)15)8-16(2)13(18)4-3-5-17/h3-7H,8H2,1-2H3/b4-3- |
| InChIKey | GAVKZXZQGFFHSL-ARJAWSKDSA-N |
| XLogP | 1.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|