C12H15NO2 — CID 115166333
N-[(3,4-dimethylphenyl)methyl]-N-methyl-2-oxoacetamide (PubChem CID 115166333) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)methyl]-N-methyl-2-oxoacetamide.
| Compound Name | N-[(3,4-dimethylphenyl)methyl]-N-methyl-2-oxoacetamide |
|---|---|
| PubChem CID | 115166333 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N-[(3,4-dimethylphenyl)methyl]-N-methyl-2-oxoacetamide |
| SMILES | Cc1ccc(CN(C)C(=O)C=O)cc1C |
| InChI | InChI=1S/C12H15NO2/c1-9-4-5-11(6-10(9)2)7-13(3)12(15)8-14/h4-6,8H,7H2,1-3H3 |
| InChIKey | LBXKOBRYPNHNSD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|