About (E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid
(E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid (PubChem CID 144832955) has the molecular formula C14H22N2O3
and a molecular weight of 266.34 g/mol. Its IUPAC name is (E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid.
Molecular Properties
| Compound Name | (E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid |
| PubChem CID | 144832955 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid |
| SMILES | C=C(/C=C\C(=C)C(=O)O)NC.CN(C)C/C=C/C=O |
| InChI | InChI=1S/C8H11NO2.C6H11NO/c1-6(8(10)11)4-5-7(2)9-3;1-7(2)5-3-4-6-8/h4-5,9H,1-2H2,3H3,(H,10,11);3-4,6H,5H2,1-2H3/b5-4-;4-3+ |
| InChIKey | FJKKZOOWRWQWKS-VCOJPVFRSA-N |
| XLogP | 1.22 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid?
The IUPAC name of (E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid (CID 144832955) is (E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid.
What is the SMILES notation for (E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid?
The canonical SMILES for (E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid is C=C(/C=C\C(=C)C(=O)O)NC.CN(C)C/C=C/C=O.
What is the InChIKey of (E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid?
The InChIKey is FJKKZOOWRWQWKS-VCOJPVFRSA-N. The full InChI is InChI=1S/C8H11NO2.C6H11NO/c1-6(8(10)11)4-5-7(2)9-3;1-7(2)5-3-4-6-8/h4-5,9H,1-2H2,3H3,(H,10,11);3-4,6H,5H2,1-2H3/b5-4-;4-3+.
What are the key properties of (E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid?
(E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid has a molecular weight of 266.34 g/mol, XLogP of 1.22, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid is sourced from PubChem (CID 144832955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).