C14H22N2O3 — CID 144832955
(E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid (PubChem CID 144832955) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is (E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid.
| Compound Name | (E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 144832955 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (E)-4-(dimethylamino)but-2-enal;(3Z)-5-(methylamino)-2-methylidenehexa-3,5-dienoic acid |
| SMILES | C=C(/C=C\C(=C)C(=O)O)NC.CN(C)C/C=C/C=O |
| InChI | InChI=1S/C8H11NO2.C6H11NO/c1-6(8(10)11)4-5-7(2)9-3;1-7(2)5-3-4-6-8/h4-5,9H,1-2H2,3H3,(H,10,11);3-4,6H,5H2,1-2H3/b5-4-;4-3+ |
| InChIKey | FJKKZOOWRWQWKS-VCOJPVFRSA-N |
| XLogP | 1.22 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|