C19H37Cl2N3O6 — CID 159888190
bis((E)-4-(dimethylamino)but-2-enoic acid);methyl (E)-4-(dimethylamino)but-2-enoate;dihydrochloride (PubChem CID 159888190) has the molecular formula C19H37Cl2N3O6 and a molecular weight of 474.43 g/mol. Its IUPAC name is bis((E)-4-(dimethylamino)but-2-enoic acid);methyl (E)-4-(dimethylamino)but-2-enoate;dihydrochloride.
| Compound Name | bis((E)-4-(dimethylamino)but-2-enoic acid);methyl (E)-4-(dimethylamino)but-2-enoate;dihydrochloride |
|---|---|
| PubChem CID | 159888190 |
| Molecular Formula | C19H37Cl2N3O6 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | bis((E)-4-(dimethylamino)but-2-enoic acid);methyl (E)-4-(dimethylamino)but-2-enoate;dihydrochloride |
| SMILES | CN(C)C/C=C/C(=O)O.CN(C)C/C=C/C(=O)O.COC(=O)/C=C/CN(C)C.Cl.Cl |
| InChI | InChI=1S/C7H13NO2.2C6H11NO2.2ClH/c1-8(2)6-4-5-7(9)10-3;2*1-7(2)5-3-4-6(8)9;;/h4-5H,6H2,1-3H3;2*3-4H,5H2,1-2H3,(H,8,9);2*1H/b5-4+;2*4-3+;; |
| InChIKey | JZZVSFHVBWSKHO-JSIBYITFSA-N |
| XLogP | 1.50 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|