C16H31N3O4 — CID 177148979
ethane;methanamine;6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]-N-(2-oxoethyl)hexanamide (PubChem CID 177148979) has the molecular formula C16H31N3O4 and a molecular weight of 329.44 g/mol. Its IUPAC name is ethane;methanamine;6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]-N-(2-oxoethyl)hexanamide.
| Compound Name | ethane;methanamine;6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]-N-(2-oxoethyl)hexanamide |
|---|---|
| PubChem CID | 177148979 |
| Molecular Formula | C16H31N3O4 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.23 |
| IUPAC Name | ethane;methanamine;6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]-N-(2-oxoethyl)hexanamide |
| SMILES | CC.CN.CN(CCCCCC(=O)NCC=O)C(=O)/C=C\C=O |
| InChI | InChI=1S/C13H20N2O4.C2H6.CH5N/c1-15(13(19)7-5-10-16)9-4-2-3-6-12(18)14-8-11-17;2*1-2/h5,7,10-11H,2-4,6,8-9H2,1H3,(H,14,18);1-2H3;2H2,1H3/b7-5-;; |
| InChIKey | IMMGFAJQCQQLOD-MWKZNRQPSA-N |
| XLogP | 0.68 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|