C23H39NO4 — CID 134388484
(3-methyl-4-pentan-3-ylcyclopentyl)methyl 6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoate (PubChem CID 134388484) has the molecular formula C23H39NO4 and a molecular weight of 393.57 g/mol. Its IUPAC name is (3-methyl-4-pentan-3-ylcyclopentyl)methyl 6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoate.
| Compound Name | (3-methyl-4-pentan-3-ylcyclopentyl)methyl 6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoate |
|---|---|
| PubChem CID | 134388484 |
| Molecular Formula | C23H39NO4 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | (3-methyl-4-pentan-3-ylcyclopentyl)methyl 6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoate |
| SMILES | CCC(CC)C1CC(COC(=O)CCCCCN(C)C(=O)/C=C\C=O)CC1C |
| InChI | InChI=1S/C23H39NO4/c1-5-20(6-2)21-16-19(15-18(21)3)17-28-23(27)12-8-7-9-13-24(4)22(26)11-10-14-25/h10-11,14,18-21H,5-9,12-13,15-17H2,1-4H3/b11-10- |
| InChIKey | BAIIOEKRKCNUDB-KHPPLWFESA-N |
| XLogP | 4.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|