C16H22BFN2O3 — CID 142846530
(Z)-N-[5-[[2-[fluoro(methyl)boranyl]-3-pyridinyl]oxy]pentyl]-N-methyl-4-oxobut-2-enamide (PubChem CID 142846530) has the molecular formula C16H22BFN2O3 and a molecular weight of 320.17 g/mol. Its IUPAC name is (Z)-N-[5-[[2-[fluoro(methyl)boranyl]-3-pyridinyl]oxy]pentyl]-N-methyl-4-oxobut-2-enamide.
| Compound Name | (Z)-N-[5-[[2-[fluoro(methyl)boranyl]-3-pyridinyl]oxy]pentyl]-N-methyl-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 142846530 |
| Molecular Formula | C16H22BFN2O3 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (Z)-N-[5-[[2-[fluoro(methyl)boranyl]-3-pyridinyl]oxy]pentyl]-N-methyl-4-oxobut-2-enamide |
| SMILES | CB(F)c1ncccc1OCCCCCN(C)C(=O)/C=C\C=O |
| InChI | InChI=1S/C16H22BFN2O3/c1-17(18)16-14(8-6-10-19-16)23-13-5-3-4-11-20(2)15(22)9-7-12-21/h6-10,12H,3-5,11,13H2,1-2H3/b9-7- |
| InChIKey | NWFTWDZDDLOLAK-CLFYSBASSA-N |
| XLogP | 1.64 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|