C14H20FNO5 — CID 2935506
4-(2-fluorophenoxy)-N,N-dimethylbutan-1-amine;oxalic acid (PubChem CID 2935506) has the molecular formula C14H20FNO5 and a molecular weight of 301.31 g/mol. Its IUPAC name is 4-(2-fluorophenoxy)-N,N-dimethylbutan-1-amine;oxalic acid.
| Compound Name | 4-(2-fluorophenoxy)-N,N-dimethylbutan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 2935506 |
| Molecular Formula | C14H20FNO5 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 4-(2-fluorophenoxy)-N,N-dimethylbutan-1-amine;oxalic acid |
| SMILES | CN(C)CCCCOc1ccccc1F.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H18FNO.C2H2O4/c1-14(2)9-5-6-10-15-12-8-4-3-7-11(12)13;3-1(4)2(5)6/h3-4,7-8H,5-6,9-10H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | PZBZLNDFIPSSGC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|