C15H22FNO3 — CID 126423069
(2R)-2-ethoxy-N-[3-(2-fluorophenoxy)propyl]-N-methylpropanamide (PubChem CID 126423069) has the molecular formula C15H22FNO3 and a molecular weight of 283.34 g/mol. Its IUPAC name is (2R)-2-ethoxy-N-[3-(2-fluorophenoxy)propyl]-N-methylpropanamide.
| Compound Name | (2R)-2-ethoxy-N-[3-(2-fluorophenoxy)propyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 126423069 |
| Molecular Formula | C15H22FNO3 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (2R)-2-ethoxy-N-[3-(2-fluorophenoxy)propyl]-N-methylpropanamide |
| SMILES | CCO[C@H](C)C(=O)N(C)CCCOc1ccccc1F |
| InChI | InChI=1S/C15H22FNO3/c1-4-19-12(2)15(18)17(3)10-7-11-20-14-9-6-5-8-13(14)16/h5-6,8-9,12H,4,7,10-11H2,1-3H3/t12-/m1/s1 |
| InChIKey | UMBZMGNUUXTGNA-GFCCVEGCSA-N |
| XLogP | 2.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|