C25H39N5O5S — CID 176555738
6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]-N-[2-oxo-2-[[1-oxo-1-[[6-(sulfanylmethyl)-3-pyridinyl]amino]propan-2-yl]amino]ethyl]hexanamide;propane (PubChem CID 176555738) has the molecular formula C25H39N5O5S and a molecular weight of 521.68 g/mol. Its IUPAC name is 6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]-N-[2-oxo-2-[[1-oxo-1-[[6-(sulfanylmethyl)-3-pyridinyl]amino]propan-2-yl]amino]ethyl]hexanamide;propane.
| Compound Name | 6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]-N-[2-oxo-2-[[1-oxo-1-[[6-(sulfanylmethyl)-3-pyridinyl]amino]propan-2-yl]amino]ethyl]hexanamide;propane |
|---|---|
| PubChem CID | 176555738 |
| Molecular Formula | C25H39N5O5S |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | 6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]-N-[2-oxo-2-[[1-oxo-1-[[6-(sulfanylmethyl)-3-pyridinyl]amino]propan-2-yl]amino]ethyl]hexanamide;propane |
| SMILES | CC(NC(=O)CNC(=O)CCCCCN(C)C(=O)/C=C\C=O)C(=O)Nc1ccc(CS)nc1.CCC |
| InChI | InChI=1S/C22H31N5O5S.C3H8/c1-16(22(32)26-17-9-10-18(15-33)23-13-17)25-20(30)14-24-19(29)7-4-3-5-11-27(2)21(31)8-6-12-28;1-3-2/h6,8-10,12-13,16,33H,3-5,7,11,14-15H2,1-2H3,(H,24,29)(H,25,30)(H,26,32);3H2,1-2H3/b8-6-; |
| InChIKey | FBPSIRAMNRDOQO-PHZXCRFESA-N |
| XLogP | 2.26 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|