C28H44N4O5S — CID 178170142
N-[2-[[1-[2,5-dimethyl-4-(sulfanylmethyl)anilino]-1-oxopropan-2-yl]amino]-2-oxoethyl]-6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanamide;propane (PubChem CID 178170142) has the molecular formula C28H44N4O5S and a molecular weight of 548.75 g/mol. Its IUPAC name is N-[2-[[1-[2,5-dimethyl-4-(sulfanylmethyl)anilino]-1-oxopropan-2-yl]amino]-2-oxoethyl]-6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanamide;propane.
| Compound Name | N-[2-[[1-[2,5-dimethyl-4-(sulfanylmethyl)anilino]-1-oxopropan-2-yl]amino]-2-oxoethyl]-6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanamide;propane |
|---|---|
| PubChem CID | 178170142 |
| Molecular Formula | C28H44N4O5S |
| Molecular Weight | 548.75 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | N-[2-[[1-[2,5-dimethyl-4-(sulfanylmethyl)anilino]-1-oxopropan-2-yl]amino]-2-oxoethyl]-6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanamide;propane |
| SMILES | CCC.Cc1cc(NC(=O)C(C)NC(=O)CNC(=O)CCCCCN(C)C(=O)/C=C\C=O)c(C)cc1CS |
| InChI | InChI=1S/C25H36N4O5S.C3H8/c1-17-14-21(18(2)13-20(17)16-35)28-25(34)19(3)27-23(32)15-26-22(31)9-6-5-7-11-29(4)24(33)10-8-12-30;1-3-2/h8,10,12-14,19,35H,5-7,9,11,15-16H2,1-4H3,(H,26,31)(H,27,32)(H,28,34);3H2,1-2H3/b10-8-; |
| InChIKey | CKKUTXGTKBKXMJ-DQMXGCRQSA-N |
| XLogP | 3.48 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.75 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|