C32H58N4O6 — CID 155417979
N-[(4S)-4,5-dimethylhexan-3-yl]-N-[[2-[(3-methoxy-5-methylheptan-4-yl)-methylamino]-2-oxoethyl]carbamoyl]-6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanamide (PubChem CID 155417979) has the molecular formula C32H58N4O6 and a molecular weight of 594.84 g/mol. Its IUPAC name is N-[(4S)-4,5-dimethylhexan-3-yl]-N-[[2-[(3-methoxy-5-methylheptan-4-yl)-methylamino]-2-oxoethyl]carbamoyl]-6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanamide.
| Compound Name | N-[(4S)-4,5-dimethylhexan-3-yl]-N-[[2-[(3-methoxy-5-methylheptan-4-yl)-methylamino]-2-oxoethyl]carbamoyl]-6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanamide |
|---|---|
| PubChem CID | 155417979 |
| Molecular Formula | C32H58N4O6 |
| Molecular Weight | 594.84 g/mol |
| Exact Mass | 594.44 |
| IUPAC Name | N-[(4S)-4,5-dimethylhexan-3-yl]-N-[[2-[(3-methoxy-5-methylheptan-4-yl)-methylamino]-2-oxoethyl]carbamoyl]-6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanamide |
| SMILES | CCC(C)C(C(CC)OC)N(C)C(=O)CNC(=O)N(C(=O)CCCCCN(C)C(=O)/C=C\C=O)C(CC)[C@@H](C)C(C)C |
| InChI | InChI=1S/C32H58N4O6/c1-11-24(6)31(27(13-3)42-10)35(9)30(40)22-33-32(41)36(26(12-2)25(7)23(4)5)29(39)18-15-14-16-20-34(8)28(38)19-17-21-37/h17,19,21,23-27,31H,11-16,18,20,22H2,1-10H3,(H,33,41)/b19-17-/t24?,25-,26?,27?,31?/m0/s1 |
| InChIKey | YAUZYTSJPRMZDF-HIQUSNAJSA-N |
| XLogP | 4.67 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.84 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|