C25H50N4O4 — CID 139469991
6-aminooxy-N-[2-[[2-[(3-methoxy-5-methylheptan-4-yl)-methylamino]-2-oxoethyl]amino]-4-methylpent-1-en-3-yl]-N-methylhexanamide (PubChem CID 139469991) has the molecular formula C25H50N4O4 and a molecular weight of 470.70 g/mol. Its IUPAC name is 6-aminooxy-N-[2-[[2-[(3-methoxy-5-methylheptan-4-yl)-methylamino]-2-oxoethyl]amino]-4-methylpent-1-en-3-yl]-N-methylhexanamide.
| Compound Name | 6-aminooxy-N-[2-[[2-[(3-methoxy-5-methylheptan-4-yl)-methylamino]-2-oxoethyl]amino]-4-methylpent-1-en-3-yl]-N-methylhexanamide |
|---|---|
| PubChem CID | 139469991 |
| Molecular Formula | C25H50N4O4 |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | 6-aminooxy-N-[2-[[2-[(3-methoxy-5-methylheptan-4-yl)-methylamino]-2-oxoethyl]amino]-4-methylpent-1-en-3-yl]-N-methylhexanamide |
| SMILES | C=C(NCC(=O)N(C)C(C(C)CC)C(CC)OC)C(C(C)C)N(C)C(=O)CCCCCON |
| InChI | InChI=1S/C25H50N4O4/c1-10-19(5)25(21(11-2)32-9)29(8)23(31)17-27-20(6)24(18(3)4)28(7)22(30)15-13-12-14-16-33-26/h18-19,21,24-25,27H,6,10-17,26H2,1-5,7-9H3 |
| InChIKey | JPKJAMKFPWSNBG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|