C28H46N4O8 — CID 166830086
4-[[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl-methylamino]-3-methylbutanoyl]amino]acetyl]-methylamino]-3-methoxy-5-methylheptanoic acid (PubChem CID 166830086) has the molecular formula C28H46N4O8 and a molecular weight of 566.70 g/mol. Its IUPAC name is 4-[[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl-methylamino]-3-methylbutanoyl]amino]acetyl]-methylamino]-3-methoxy-5-methylheptanoic acid.
| Compound Name | 4-[[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl-methylamino]-3-methylbutanoyl]amino]acetyl]-methylamino]-3-methoxy-5-methylheptanoic acid |
|---|---|
| PubChem CID | 166830086 |
| Molecular Formula | C28H46N4O8 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | 4-[[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl-methylamino]-3-methylbutanoyl]amino]acetyl]-methylamino]-3-methoxy-5-methylheptanoic acid |
| SMILES | CCC(C)C(C(CC(=O)O)OC)N(C)C(=O)CNC(=O)C(C(C)C)N(C)C(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C28H46N4O8/c1-8-19(4)27(20(40-7)16-25(37)38)31(6)24(36)17-29-28(39)26(18(2)3)30(5)21(33)12-10-9-11-15-32-22(34)13-14-23(32)35/h13-14,18-20,26-27H,8-12,15-17H2,1-7H3,(H,29,39)(H,37,38) |
| InChIKey | JMTAOIGWIDUZDE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 153.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|