C27H39N5O9S — CID 166892174
[4-[2-[[2-[[methyl-[(Z)-4-oxobut-2-enoyl]amino]oxycarbonylamino]acetyl]amino]propanoylamino]phenyl]methyl N-(2-methylbutyl)-N-(2-methylsulfinylethyl)carbamate (PubChem CID 166892174) has the molecular formula C27H39N5O9S and a molecular weight of 609.70 g/mol. Its IUPAC name is [4-[2-[[2-[[methyl-[(Z)-4-oxobut-2-enoyl]amino]oxycarbonylamino]acetyl]amino]propanoylamino]phenyl]methyl N-(2-methylbutyl)-N-(2-methylsulfinylethyl)carbamate.
| Compound Name | [4-[2-[[2-[[methyl-[(Z)-4-oxobut-2-enoyl]amino]oxycarbonylamino]acetyl]amino]propanoylamino]phenyl]methyl N-(2-methylbutyl)-N-(2-methylsulfinylethyl)carbamate |
|---|---|
| PubChem CID | 166892174 |
| Molecular Formula | C27H39N5O9S |
| Molecular Weight | 609.70 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | [4-[2-[[2-[[methyl-[(Z)-4-oxobut-2-enoyl]amino]oxycarbonylamino]acetyl]amino]propanoylamino]phenyl]methyl N-(2-methylbutyl)-N-(2-methylsulfinylethyl)carbamate |
| SMILES | CCC(C)CN(CCS(C)=O)C(=O)OCc1ccc(NC(=O)C(C)NC(=O)CNC(=O)ON(C)C(=O)/C=C\C=O)cc1 |
| InChI | InChI=1S/C27H39N5O9S/c1-6-19(2)17-32(13-15-42(5)39)27(38)40-18-21-9-11-22(12-10-21)30-25(36)20(3)29-23(34)16-28-26(37)41-31(4)24(35)8-7-14-33/h7-12,14,19-20H,6,13,15-18H2,1-5H3,(H,28,37)(H,29,34)(H,30,36)/b8-7- |
| InChIKey | LJZIJDBEPNMHDK-FPLPWBNLSA-N |
| XLogP | 1.35 |
| TPSA | 180.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.70 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|