About (Z)-but-2-enedial;(Z)-N-[4-(dimethylamino)phenyl]-N-methyl-4-oxobut-2-enamide
(Z)-but-2-enedial;(Z)-N-[4-(dimethylamino)phenyl]-N-methyl-4-oxobut-2-enamide (PubChem CID 145403709) has the molecular formula C17H20N2O4
and a molecular weight of 316.36 g/mol. Its IUPAC name is (Z)-but-2-enedial;(Z)-N-[4-(dimethylamino)phenyl]-N-methyl-4-oxobut-2-enamide.
Molecular Properties
| Compound Name | (Z)-but-2-enedial;(Z)-N-[4-(dimethylamino)phenyl]-N-methyl-4-oxobut-2-enamide |
| PubChem CID | 145403709 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (Z)-but-2-enedial;(Z)-N-[4-(dimethylamino)phenyl]-N-methyl-4-oxobut-2-enamide |
| SMILES | CN(C)c1ccc(N(C)C(=O)/C=C\C=O)cc1.O=C/C=C\C=O |
| InChI | InChI=1S/C13H16N2O2.C4H4O2/c1-14(2)11-6-8-12(9-7-11)15(3)13(17)5-4-10-16;5-3-1-2-4-6/h4-10H,1-3H3;1-4H/b5-4-;2-1- |
| InChIKey | PTYFPQQLCQVDGK-GGAKEQGOSA-N |
| XLogP | 1.41 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedial;(Z)-N-[4-(dimethylamino)phenyl]-N-methyl-4-oxobut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedial;(Z)-N-[4-(dimethylamino)phenyl]-N-methyl-4-oxobut-2-enamide?
The IUPAC name of (Z)-but-2-enedial;(Z)-N-[4-(dimethylamino)phenyl]-N-methyl-4-oxobut-2-enamide (CID 145403709) is (Z)-but-2-enedial;(Z)-N-[4-(dimethylamino)phenyl]-N-methyl-4-oxobut-2-enamide.
What is the SMILES notation for (Z)-but-2-enedial;(Z)-N-[4-(dimethylamino)phenyl]-N-methyl-4-oxobut-2-enamide?
The canonical SMILES for (Z)-but-2-enedial;(Z)-N-[4-(dimethylamino)phenyl]-N-methyl-4-oxobut-2-enamide is CN(C)c1ccc(N(C)C(=O)/C=C\C=O)cc1.O=C/C=C\C=O.
What is the InChIKey of (Z)-but-2-enedial;(Z)-N-[4-(dimethylamino)phenyl]-N-methyl-4-oxobut-2-enamide?
The InChIKey is PTYFPQQLCQVDGK-GGAKEQGOSA-N. The full InChI is InChI=1S/C13H16N2O2.C4H4O2/c1-14(2)11-6-8-12(9-7-11)15(3)13(17)5-4-10-16;5-3-1-2-4-6/h4-10H,1-3H3;1-4H/b5-4-;2-1-.
What are the key properties of (Z)-but-2-enedial;(Z)-N-[4-(dimethylamino)phenyl]-N-methyl-4-oxobut-2-enamide?
(Z)-but-2-enedial;(Z)-N-[4-(dimethylamino)phenyl]-N-methyl-4-oxobut-2-enamide has a molecular weight of 316.36 g/mol, XLogP of 1.41, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedial;(Z)-N-[4-(dimethylamino)phenyl]-N-methyl-4-oxobut-2-enamide is sourced from PubChem (CID 145403709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).