C7H14N2O3 — CID 20719167
N-[2-(dimethylamino)-2-oxoethyl]-3-hydroxypropanamide (PubChem CID 20719167) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-oxoethyl]-3-hydroxypropanamide.
| Compound Name | N-[2-(dimethylamino)-2-oxoethyl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 20719167 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | N-[2-(dimethylamino)-2-oxoethyl]-3-hydroxypropanamide |
| SMILES | CN(C)C(=O)CNC(=O)CCO |
| InChI | InChI=1S/C7H14N2O3/c1-9(2)7(12)5-8-6(11)3-4-10/h10H,3-5H2,1-2H3,(H,8,11) |
| InChIKey | LAMBWXGIXRLSQQ-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |