C11H20N3O4+ — CID 90239142
[4-[[2-(dimethylamino)-2-oxoethyl]amino]-2,4-dioxobutanoyl]-trimethylazanium (PubChem CID 90239142) has the molecular formula C11H20N3O4+ and a molecular weight of 258.30 g/mol. Its IUPAC name is [4-[[2-(dimethylamino)-2-oxoethyl]amino]-2,4-dioxobutanoyl]-trimethylazanium.
| Compound Name | [4-[[2-(dimethylamino)-2-oxoethyl]amino]-2,4-dioxobutanoyl]-trimethylazanium |
|---|---|
| PubChem CID | 90239142 |
| Molecular Formula | C11H20N3O4+ |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | [4-[[2-(dimethylamino)-2-oxoethyl]amino]-2,4-dioxobutanoyl]-trimethylazanium |
| SMILES | CN(C)C(=O)CNC(=O)CC(=O)C(=O)[N+](C)(C)C |
| InChI | InChI=1S/C11H19N3O4/c1-13(2)10(17)7-12-9(16)6-8(15)11(18)14(3,4)5/h6-7H2,1-5H3/p+1 |
| InChIKey | WPSITJIDHBFMOD-UHFFFAOYSA-O |
| XLogP | -1.62 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|