C9H16N4O5 — CID 61197433
2-[[2-[[2-(dimethylamino)-2-oxoethyl]carbamoylamino]acetyl]amino]acetic acid (PubChem CID 61197433) has the molecular formula C9H16N4O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2-[[2-[[2-(dimethylamino)-2-oxoethyl]carbamoylamino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-(dimethylamino)-2-oxoethyl]carbamoylamino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 61197433 |
| Molecular Formula | C9H16N4O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-[[2-[[2-(dimethylamino)-2-oxoethyl]carbamoylamino]acetyl]amino]acetic acid |
| SMILES | CN(C)C(=O)CNC(=O)NCC(=O)NCC(=O)O |
| InChI | InChI=1S/C9H16N4O5/c1-13(2)7(15)4-12-9(18)11-3-6(14)10-5-8(16)17/h3-5H2,1-2H3,(H,10,14)(H,16,17)(H2,11,12,18) |
| InChIKey | AAERSKCRWOLLGF-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |