C8H18N2 — CID 138623252
1-butyl-1-ethenyl-2,2-dimethylhydrazine (PubChem CID 138623252) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 1-butyl-1-ethenyl-2,2-dimethylhydrazine.
| Compound Name | 1-butyl-1-ethenyl-2,2-dimethylhydrazine |
|---|---|
| PubChem CID | 138623252 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 1-butyl-1-ethenyl-2,2-dimethylhydrazine |
| SMILES | C=CN(CCCC)N(C)C |
| InChI | InChI=1S/C8H18N2/c1-5-7-8-10(6-2)9(3)4/h6H,2,5,7-8H2,1,3-4H3 |
| InChIKey | FIIJPJICXSYIAU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|