C9H20N2 — CID 142276729
N'-butyl-N'-ethenyl-N,N-dimethylmethanediamine (PubChem CID 142276729) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is N'-butyl-N'-ethenyl-N,N-dimethylmethanediamine.
| Compound Name | N'-butyl-N'-ethenyl-N,N-dimethylmethanediamine |
|---|---|
| PubChem CID | 142276729 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | N'-butyl-N'-ethenyl-N,N-dimethylmethanediamine |
| SMILES | C=CN(CCCC)CN(C)C |
| InChI | InChI=1S/C9H20N2/c1-5-7-8-11(6-2)9-10(3)4/h6H,2,5,7-9H2,1,3-4H3 |
| InChIKey | BTIGOCVPUWEKAO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|