C14H28N2 — CID 57432921
1,1-dibutyl-2,2-bis(prop-2-enyl)hydrazine (PubChem CID 57432921) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 1,1-dibutyl-2,2-bis(prop-2-enyl)hydrazine.
| Compound Name | 1,1-dibutyl-2,2-bis(prop-2-enyl)hydrazine |
|---|---|
| PubChem CID | 57432921 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 1,1-dibutyl-2,2-bis(prop-2-enyl)hydrazine |
| SMILES | C=CCN(CC=C)N(CCCC)CCCC |
| InChI | InChI=1S/C14H28N2/c1-5-9-13-16(14-10-6-2)15(11-7-3)12-8-4/h7-8H,3-6,9-14H2,1-2H3 |
| InChIKey | ODCPROOPOMVQBV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|