C17H33N — CID 10156078
N,N-bis(prop-2-enyl)undecan-1-amine (PubChem CID 10156078) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)undecan-1-amine.
| Compound Name | N,N-bis(prop-2-enyl)undecan-1-amine |
|---|---|
| PubChem CID | 10156078 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | N,N-bis(prop-2-enyl)undecan-1-amine |
| SMILES | C=CCN(CC=C)CCCCCCCCCCC |
| InChI | InChI=1S/C17H33N/c1-4-7-8-9-10-11-12-13-14-17-18(15-5-2)16-6-3/h5-6H,2-4,7-17H2,1H3 |
| InChIKey | DWCJKORELWLSIP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|