C28H54N2 — CID 174680920
N,N-bis(prop-2-enyl)hexadecan-1-amine;N-prop-2-enylprop-2-en-1-amine (PubChem CID 174680920) has the molecular formula C28H54N2 and a molecular weight of 418.75 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)hexadecan-1-amine;N-prop-2-enylprop-2-en-1-amine.
| Compound Name | N,N-bis(prop-2-enyl)hexadecan-1-amine;N-prop-2-enylprop-2-en-1-amine |
|---|---|
| PubChem CID | 174680920 |
| Molecular Formula | C28H54N2 |
| Molecular Weight | 418.75 g/mol |
| Exact Mass | 418.43 |
| IUPAC Name | N,N-bis(prop-2-enyl)hexadecan-1-amine;N-prop-2-enylprop-2-en-1-amine |
| SMILES | C=CCN(CC=C)CCCCCCCCCCCCCCCC.C=CCNCC=C |
| InChI | InChI=1S/C22H43N.C6H11N/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-22-23(20-5-2)21-6-3;1-3-5-7-6-4-2/h5-6H,2-4,7-22H2,1H3;3-4,7H,1-2,5-6H2 |
| InChIKey | ZRAZYXFGQXAOBK-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.75 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|