C24H48ClN — CID 88725807
N,N-bis(prop-2-enyl)octadecan-1-amine;hydrochloride (PubChem CID 88725807) has the molecular formula C24H48ClN and a molecular weight of 386.11 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)octadecan-1-amine;hydrochloride.
| Compound Name | N,N-bis(prop-2-enyl)octadecan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 88725807 |
| Molecular Formula | C24H48ClN |
| Molecular Weight | 386.11 g/mol |
| Exact Mass | 385.35 |
| IUPAC Name | N,N-bis(prop-2-enyl)octadecan-1-amine;hydrochloride |
| SMILES | C=CCN(CC=C)CCCCCCCCCCCCCCCCCC.Cl |
| InChI | InChI=1S/C24H47N.ClH/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-25(22-5-2)23-6-3;/h5-6H,2-4,7-24H2,1H3;1H |
| InChIKey | SQUQLLWXECGMLO-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.11 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|