C16H38N2O — CID 172702997
1,1,2,2-tetrabutylhydrazine;hydrate (PubChem CID 172702997) has the molecular formula C16H38N2O and a molecular weight of 274.49 g/mol. Its IUPAC name is 1,1,2,2-tetrabutylhydrazine;hydrate.
| Compound Name | 1,1,2,2-tetrabutylhydrazine;hydrate |
|---|---|
| PubChem CID | 172702997 |
| Molecular Formula | C16H38N2O |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.30 |
| IUPAC Name | 1,1,2,2-tetrabutylhydrazine;hydrate |
| SMILES | CCCCN(CCCC)N(CCCC)CCCC.O |
| InChI | InChI=1S/C16H36N2.H2O/c1-5-9-13-17(14-10-6-2)18(15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H2 |
| InChIKey | DFDWTGRKNCFKKM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|