C11H24N2 — CID 146420485
N'-hept-1-en-3-yl-N,N,N'-trimethylmethanediamine (PubChem CID 146420485) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is N'-hept-1-en-3-yl-N,N,N'-trimethylmethanediamine.
| Compound Name | N'-hept-1-en-3-yl-N,N,N'-trimethylmethanediamine |
|---|---|
| PubChem CID | 146420485 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | N'-hept-1-en-3-yl-N,N,N'-trimethylmethanediamine |
| SMILES | C=CC(CCCC)N(C)CN(C)C |
| InChI | InChI=1S/C11H24N2/c1-6-8-9-11(7-2)13(5)10-12(3)4/h7,11H,2,6,8-10H2,1,3-5H3 |
| InChIKey | ACUUJZFDOREKJI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|