C16H32N2O — CID 139697213
6-[4-(dimethylamino)hex-5-enoxy]-N,N-dimethylhex-1-en-3-amine (PubChem CID 139697213) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is 6-[4-(dimethylamino)hex-5-enoxy]-N,N-dimethylhex-1-en-3-amine.
| Compound Name | 6-[4-(dimethylamino)hex-5-enoxy]-N,N-dimethylhex-1-en-3-amine |
|---|---|
| PubChem CID | 139697213 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | 6-[4-(dimethylamino)hex-5-enoxy]-N,N-dimethylhex-1-en-3-amine |
| SMILES | C=CC(CCCOCCCC(C=C)N(C)C)N(C)C |
| InChI | InChI=1S/C16H32N2O/c1-7-15(17(3)4)11-9-13-19-14-10-12-16(8-2)18(5)6/h7-8,15-16H,1-2,9-14H2,3-6H3 |
| InChIKey | QJNSZABWAAQNJQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|