C21H39N — CID 87378366
N,N-bis(hept-1-en-3-yl)hept-1-en-3-amine (PubChem CID 87378366) has the molecular formula C21H39N and a molecular weight of 305.55 g/mol. Its IUPAC name is N,N-bis(hept-1-en-3-yl)hept-1-en-3-amine.
| Compound Name | N,N-bis(hept-1-en-3-yl)hept-1-en-3-amine |
|---|---|
| PubChem CID | 87378366 |
| Molecular Formula | C21H39N |
| Molecular Weight | 305.55 g/mol |
| Exact Mass | 305.31 |
| IUPAC Name | N,N-bis(hept-1-en-3-yl)hept-1-en-3-amine |
| SMILES | C=CC(CCCC)N(C(C=C)CCCC)C(C=C)CCCC |
| InChI | InChI=1S/C21H39N/c1-7-13-16-19(10-4)22(20(11-5)17-14-8-2)21(12-6)18-15-9-3/h10-12,19-21H,4-9,13-18H2,1-3H3 |
| InChIKey | DHVYIEFFQWCBLT-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.55 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|