About (E)-1-N,1-N,3-N,3-N-tetramethylhept-1-ene-1,3-diamine
(E)-1-N,1-N,3-N,3-N-tetramethylhept-1-ene-1,3-diamine (PubChem CID 121218355) has the molecular formula C11H24N2
and a molecular weight of 184.33 g/mol. Its IUPAC name is (E)-1-N,1-N,3-N,3-N-tetramethylhept-1-ene-1,3-diamine.
Analyze (E)-1-N,1-N,3-N,3-N-tetramethylhept-1-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-N,1-N,3-N,3-N-tetramethylhept-1-ene-1,3-diamine?
The IUPAC name of (E)-1-N,1-N,3-N,3-N-tetramethylhept-1-ene-1,3-diamine (CID 121218355) is (E)-1-N,1-N,3-N,3-N-tetramethylhept-1-ene-1,3-diamine.
What is the SMILES notation for (E)-1-N,1-N,3-N,3-N-tetramethylhept-1-ene-1,3-diamine?
The canonical SMILES for (E)-1-N,1-N,3-N,3-N-tetramethylhept-1-ene-1,3-diamine is CCCCC(/C=C/N(C)C)N(C)C.
What is the InChIKey of (E)-1-N,1-N,3-N,3-N-tetramethylhept-1-ene-1,3-diamine?
The InChIKey is TWOMKGBWRGIFHI-MDZDMXLPSA-N. The full InChI is InChI=1S/C11H24N2/c1-6-7-8-11(13(4)5)9-10-12(2)3/h9-11H,6-8H2,1-5H3/b10-9+.
What are the key properties of (E)-1-N,1-N,3-N,3-N-tetramethylhept-1-ene-1,3-diamine?
(E)-1-N,1-N,3-N,3-N-tetramethylhept-1-ene-1,3-diamine has a molecular weight of 184.33 g/mol, XLogP of 2.18, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-N,1-N,3-N,3-N-tetramethylhept-1-ene-1,3-diamine is sourced from PubChem (CID 121218355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).