C26H35NO3 — CID 156846239
(3E,6E,10E,13E)-13-hydroxyimino-6,11-dimethyl-8,9-dimethylidene-4-[(Z)-prop-1-enyl]nonadeca-1,3,6,10-tetraene-5,12-dione (PubChem CID 156846239) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is (3E,6E,10E,13E)-13-hydroxyimino-6,11-dimethyl-8,9-dimethylidene-4-[(Z)-prop-1-enyl]nonadeca-1,3,6,10-tetraene-5,12-dione.
| Compound Name | (3E,6E,10E,13E)-13-hydroxyimino-6,11-dimethyl-8,9-dimethylidene-4-[(Z)-prop-1-enyl]nonadeca-1,3,6,10-tetraene-5,12-dione |
|---|---|
| PubChem CID | 156846239 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | (3E,6E,10E,13E)-13-hydroxyimino-6,11-dimethyl-8,9-dimethylidene-4-[(Z)-prop-1-enyl]nonadeca-1,3,6,10-tetraene-5,12-dione |
| SMILES | C=C/C=C(\C=C/C)C(=O)/C(C)=C/C(=C)C(=C)/C=C(\C)C(=O)/C(CCCCCC)=N/O |
| InChI | InChI=1S/C26H35NO3/c1-8-11-12-13-16-24(27-30)26(29)22(7)18-20(5)19(4)17-21(6)25(28)23(14-9-2)15-10-3/h9-10,14-15,17-18,30H,2,4-5,8,11-13,16H2,1,3,6-7H3/b15-10-,21-17+,22-18+,23-14+,27-24+ |
| InChIKey | RSZHXULSMDHKRV-OCNHGCRMSA-N |
| XLogP | 6.62 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|