C15H20O2 — CID 142047884
(2E,4E,6E,8Z)-4-ethylidene-3-hydroxy-6-[(Z)-prop-1-enyl]deca-2,6,8-trien-5-one (PubChem CID 142047884) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (2E,4E,6E,8Z)-4-ethylidene-3-hydroxy-6-[(Z)-prop-1-enyl]deca-2,6,8-trien-5-one.
| Compound Name | (2E,4E,6E,8Z)-4-ethylidene-3-hydroxy-6-[(Z)-prop-1-enyl]deca-2,6,8-trien-5-one |
|---|---|
| PubChem CID | 142047884 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (2E,4E,6E,8Z)-4-ethylidene-3-hydroxy-6-[(Z)-prop-1-enyl]deca-2,6,8-trien-5-one |
| SMILES | C/C=C\C=C(/C=C\C)C(=O)C(=C/C)/C(O)=C\C |
| InChI | InChI=1S/C15H20O2/c1-5-9-11-12(10-6-2)15(17)13(7-3)14(16)8-4/h5-11,16H,1-4H3/b9-5-,10-6-,12-11+,13-7+,14-8+ |
| InChIKey | GSCIRRWONDQVKV-OGTRUACRSA-N |
| XLogP | 4.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|