C23H34BrNO2 — CID 174322728
[(5E,6Z,10E,12Z)-5-ethylidene-4,4-dimethyl-2-(methylamino)-8-methylidene-9-oxo-10-[(Z)-prop-1-enyl]tetradeca-6,10,12-trien-2-yl] hypobromite (PubChem CID 174322728) has the molecular formula C23H34BrNO2 and a molecular weight of 436.43 g/mol. Its IUPAC name is [(5E,6Z,10E,12Z)-5-ethylidene-4,4-dimethyl-2-(methylamino)-8-methylidene-9-oxo-10-[(Z)-prop-1-enyl]tetradeca-6,10,12-trien-2-yl] hypobromite.
| Compound Name | [(5E,6Z,10E,12Z)-5-ethylidene-4,4-dimethyl-2-(methylamino)-8-methylidene-9-oxo-10-[(Z)-prop-1-enyl]tetradeca-6,10,12-trien-2-yl] hypobromite |
|---|---|
| PubChem CID | 174322728 |
| Molecular Formula | C23H34BrNO2 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | [(5E,6Z,10E,12Z)-5-ethylidene-4,4-dimethyl-2-(methylamino)-8-methylidene-9-oxo-10-[(Z)-prop-1-enyl]tetradeca-6,10,12-trien-2-yl] hypobromite |
| SMILES | C=C(/C=C\C(=C/C)C(C)(C)CC(C)(NC)OBr)C(=O)C(/C=C\C)=C/C=C\C |
| InChI | InChI=1S/C23H34BrNO2/c1-9-12-14-19(13-10-2)21(26)18(4)15-16-20(11-3)22(5,6)17-23(7,25-8)27-24/h9-16,25H,4,17H2,1-3,5-8H3/b12-9-,13-10-,16-15-,19-14+,20-11+ |
| InChIKey | TVRFCMZOBGVLRY-ZTGYXFRPSA-N |
| XLogP | 6.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|