C11H16O — CID 168899282
(3E)-3-(2-methylprop-1-enoxymethyl)hexa-1,3,5-triene (PubChem CID 168899282) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (3E)-3-(2-methylprop-1-enoxymethyl)hexa-1,3,5-triene.
| Compound Name | (3E)-3-(2-methylprop-1-enoxymethyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 168899282 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (3E)-3-(2-methylprop-1-enoxymethyl)hexa-1,3,5-triene |
| SMILES | C=C/C=C(\C=C)COC=C(C)C |
| InChI | InChI=1S/C11H16O/c1-5-7-11(6-2)9-12-8-10(3)4/h5-8H,1-2,9H2,3-4H3/b11-7+ |
| InChIKey | HQZPKNYOVMEBPF-YRNVUSSQSA-N |
| XLogP | 3.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|