C16H27NO2 — CID 145157561
4-[(2E)-2-ethenylpenta-2,4-dienoxy]-1-hydroxy-2,2,6,6-tetramethylpiperidine (PubChem CID 145157561) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 4-[(2E)-2-ethenylpenta-2,4-dienoxy]-1-hydroxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4-[(2E)-2-ethenylpenta-2,4-dienoxy]-1-hydroxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 145157561 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 4-[(2E)-2-ethenylpenta-2,4-dienoxy]-1-hydroxy-2,2,6,6-tetramethylpiperidine |
| SMILES | C=C/C=C(\C=C)COC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C16H27NO2/c1-7-9-13(8-2)12-19-14-10-15(3,4)17(18)16(5,6)11-14/h7-9,14,18H,1-2,10-12H2,3-6H3/b13-9+ |
| InChIKey | LYSWLDUQCUVEED-UKTHLTGXSA-N |
| XLogP | 3.71 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|