C48H52F6N6O6 — CID 141228118
1-acetyl-5-[2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-2,3-dihydroindole-7-carbonitrile (PubChem CID 141228118) has the molecular formula C48H52F6N6O6 and a molecular weight of 922.97 g/mol. Its IUPAC name is 1-acetyl-5-[2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-2,3-dihydroindole-7-carbonitrile.
| Compound Name | 1-acetyl-5-[2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-2,3-dihydroindole-7-carbonitrile |
|---|---|
| PubChem CID | 141228118 |
| Molecular Formula | C48H52F6N6O6 |
| Molecular Weight | 922.97 g/mol |
| Exact Mass | 922.39 |
| IUPAC Name | 1-acetyl-5-[2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-2,3-dihydroindole-7-carbonitrile |
| SMILES | CC(=O)N1CCc2cc(CC(C)NCCOc3ccccc3OCC(F)(F)F)cc(C#N)c21.CC(=O)N1CCc2cc(CC(C)NCCOc3ccccc3OCC(F)(F)F)cc(C#N)c21 |
| InChI | InChI=1S/2C24H26F3N3O3/c2*1-16(11-18-12-19-7-9-30(17(2)31)23(19)20(13-18)14-28)29-8-10-32-21-5-3-4-6-22(21)33-15-24(25,26)27/h2*3-6,12-13,16,29H,7-11,15H2,1-2H3 |
| InChIKey | LFAJVARSVZKKLQ-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.97 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|