C25H30F3N3O4 — CID 139672081
1-acetyl-N-methyl-5-[(2R)-2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-2,3-dihydroindole-7-carboxamide (PubChem CID 139672081) has the molecular formula C25H30F3N3O4 and a molecular weight of 493.53 g/mol. Its IUPAC name is 1-acetyl-N-methyl-5-[(2R)-2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-2,3-dihydroindole-7-carboxamide.
| Compound Name | 1-acetyl-N-methyl-5-[(2R)-2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-2,3-dihydroindole-7-carboxamide |
|---|---|
| PubChem CID | 139672081 |
| Molecular Formula | C25H30F3N3O4 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 1-acetyl-N-methyl-5-[(2R)-2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-2,3-dihydroindole-7-carboxamide |
| SMILES | CNC(=O)c1cc(C[C@@H](C)NCCOc2ccccc2OCC(F)(F)F)cc2c1N(C(C)=O)CC2 |
| InChI | InChI=1S/C25H30F3N3O4/c1-16(30-9-11-34-21-6-4-5-7-22(21)35-15-25(26,27)28)12-18-13-19-8-10-31(17(2)32)23(19)20(14-18)24(33)29-3/h4-7,13-14,16,30H,8-12,15H2,1-3H3,(H,29,33)/t16-/m1/s1 |
| InChIKey | BTIRBRYDQFUUPL-MRXNPFEDSA-N |
| XLogP | 3.50 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|