C18H8F4N2O3S — CID 25008507
4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-fluorophenoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 25008507) has the molecular formula C18H8F4N2O3S and a molecular weight of 408.33 g/mol. Its IUPAC name is 4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-fluorophenoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-fluorophenoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 25008507 |
| Molecular Formula | C18H8F4N2O3S |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-fluorophenoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(/C=C3\SC(=O)NC3=O)cc2F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H8F4N2O3S/c19-12-6-9(7-15-16(25)24-17(26)28-15)1-4-14(12)27-13-3-2-10(8-23)5-11(13)18(20,21)22/h1-7H,(H,24,25,26)/b15-7- |
| InChIKey | ZUNLEQPHCSYBPE-CHHVJCJISA-N |
| XLogP | 4.83 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|