C23H18F4N4O2S — CID 69269694
4-[2-fluoro-4-[[2-(4-methylpiperazin-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]phenoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 69269694) has the molecular formula C23H18F4N4O2S and a molecular weight of 490.48 g/mol. Its IUPAC name is 4-[2-fluoro-4-[[2-(4-methylpiperazin-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]phenoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[2-fluoro-4-[[2-(4-methylpiperazin-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]phenoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 69269694 |
| Molecular Formula | C23H18F4N4O2S |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 4-[2-fluoro-4-[[2-(4-methylpiperazin-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]phenoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | CN1CCN(C2=NC(=O)C(=Cc3ccc(Oc4ccc(C#N)cc4C(F)(F)F)c(F)c3)S2)CC1 |
| InChI | InChI=1S/C23H18F4N4O2S/c1-30-6-8-31(9-7-30)22-29-21(32)20(34-22)12-14-2-5-19(17(24)11-14)33-18-4-3-15(13-28)10-16(18)23(25,26)27/h2-5,10-12H,6-9H2,1H3 |
| InChIKey | VRZJOXPQJHCJSM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 68.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|