C17H9BrF3NO4S — CID 88901469
(5Z)-5-[[4-[2-bromo-4-(trifluoromethyl)phenoxy]-3-hydroxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 88901469) has the molecular formula C17H9BrF3NO4S and a molecular weight of 460.23 g/mol. Its IUPAC name is (5Z)-5-[[4-[2-bromo-4-(trifluoromethyl)phenoxy]-3-hydroxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[2-bromo-4-(trifluoromethyl)phenoxy]-3-hydroxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 88901469 |
| Molecular Formula | C17H9BrF3NO4S |
| Molecular Weight | 460.23 g/mol |
| Exact Mass | 458.94 |
| IUPAC Name | (5Z)-5-[[4-[2-bromo-4-(trifluoromethyl)phenoxy]-3-hydroxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(Oc3ccc(C(F)(F)F)cc3Br)c(O)c2)S1 |
| InChI | InChI=1S/C17H9BrF3NO4S/c18-10-7-9(17(19,20)21)2-4-12(10)26-13-3-1-8(5-11(13)23)6-14-15(24)22-16(25)27-14/h1-7,23H,(H,22,24,25)/b14-6- |
| InChIKey | OAJMHNQLVUUJBC-NSIKDUERSA-N |
| XLogP | 5.29 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.23 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|