C48H47ClN2O5 — CID 90946830
3-[2-[3-(1-adamantyl)-4-[3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]-3-chlorophenyl]prop-2-enoyloxy]phenyl]pyrimidin-5-yl]prop-2-enoic acid (PubChem CID 90946830) has the molecular formula C48H47ClN2O5 and a molecular weight of 767.37 g/mol. Its IUPAC name is 3-[2-[3-(1-adamantyl)-4-[3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]-3-chlorophenyl]prop-2-enoyloxy]phenyl]pyrimidin-5-yl]prop-2-enoic acid.
| Compound Name | 3-[2-[3-(1-adamantyl)-4-[3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]-3-chlorophenyl]prop-2-enoyloxy]phenyl]pyrimidin-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90946830 |
| Molecular Formula | C48H47ClN2O5 |
| Molecular Weight | 767.37 g/mol |
| Exact Mass | 766.32 |
| IUPAC Name | 3-[2-[3-(1-adamantyl)-4-[3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]-3-chlorophenyl]prop-2-enoyloxy]phenyl]pyrimidin-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cnc(-c2ccc(OC(=O)C=Cc3ccc(-c4ccc(O)c(C56CC7CC(CC(C7)C5)C6)c4)c(Cl)c3)c(C34CC5CC(CC(C5)C3)C4)c2)nc1 |
| InChI | InChI=1S/C48H47ClN2O5/c49-41-17-28(1-6-38(41)36-4-7-42(52)39(18-36)47-20-30-11-31(21-47)13-32(12-30)22-47)3-10-45(55)56-43-8-5-37(46-50-26-29(27-51-46)2-9-44(53)54)19-40(43)48-23-33-14-34(24-48)16-35(15-33)25-48/h1-10,17-19,26-27,30-35,52H,11-16,20-25H2,(H,53,54) |
| InChIKey | SUWXXSAFGDDPNF-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 109.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.37 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|