C26H30N2O4 — CID 137037476
ethyl 3-[2-[5-(1-adamantyl)-4-hydroxy-2-methoxyphenyl]pyrimidin-5-yl]prop-2-enoate (PubChem CID 137037476) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is ethyl 3-[2-[5-(1-adamantyl)-4-hydroxy-2-methoxyphenyl]pyrimidin-5-yl]prop-2-enoate.
| Compound Name | ethyl 3-[2-[5-(1-adamantyl)-4-hydroxy-2-methoxyphenyl]pyrimidin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 137037476 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | ethyl 3-[2-[5-(1-adamantyl)-4-hydroxy-2-methoxyphenyl]pyrimidin-5-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cnc(-c2cc(C34CC5CC(CC(C5)C3)C4)c(O)cc2OC)nc1 |
| InChI | InChI=1S/C26H30N2O4/c1-3-32-24(30)5-4-16-14-27-25(28-15-16)20-9-21(22(29)10-23(20)31-2)26-11-17-6-18(12-26)8-19(7-17)13-26/h4-5,9-10,14-15,17-19,29H,3,6-8,11-13H2,1-2H3 |
| InChIKey | SPFNTGFUORJXSC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|