C30H30BrF3N9O+ — CID 142253931
[amino-[(Z)-aminodiazenyl]methylidene]-[4-[(N-[N'-[3-bromo-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidoyl]-4-cyclohexylanilino)methyl]benzoyl]azanium (PubChem CID 142253931) has the molecular formula C30H30BrF3N9O+ and a molecular weight of 669.53 g/mol. Its IUPAC name is [amino-[(Z)-aminodiazenyl]methylidene]-[4-[(N-[N'-[3-bromo-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidoyl]-4-cyclohexylanilino)methyl]benzoyl]azanium.
| Compound Name | [amino-[(Z)-aminodiazenyl]methylidene]-[4-[(N-[N'-[3-bromo-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidoyl]-4-cyclohexylanilino)methyl]benzoyl]azanium |
|---|---|
| PubChem CID | 142253931 |
| Molecular Formula | C30H30BrF3N9O+ |
| Molecular Weight | 669.53 g/mol |
| Exact Mass | 668.17 |
| IUPAC Name | [amino-[(Z)-aminodiazenyl]methylidene]-[4-[(N-[N'-[3-bromo-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidoyl]-4-cyclohexylanilino)methyl]benzoyl]azanium |
| SMILES | N#CN/C(=N\c1cc(Br)cc(C(F)(F)F)c1)N(Cc1ccc(C(=O)/[NH+]=C(N)\N=N/N)cc1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C30H29BrF3N9O/c31-24-14-23(30(32,33)34)15-25(16-24)39-29(38-18-35)43(26-12-10-21(11-13-26)20-4-2-1-3-5-20)17-19-6-8-22(9-7-19)27(44)40-28(36)41-42-37/h6-16,20H,1-5,17H2,(H,38,39)(H4,36,37,40,41,44)/p+1 |
| InChIKey | NXTDUBSZJHVJBZ-UHFFFAOYSA-O |
| XLogP | 5.14 |
| TPSA | 159.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|