C31H31Cl2N5O4 — CID 59123115
(2R)-3-[[4-[(N-[N-cyano-N'-(3,5-dichlorophenyl)carbamimidoyl]-4-cyclohexylanilino)methyl]benzoyl]amino]-2-hydroxypropanoic acid (PubChem CID 59123115) has the molecular formula C31H31Cl2N5O4 and a molecular weight of 608.53 g/mol. Its IUPAC name is (2R)-3-[[4-[(N-[N-cyano-N'-(3,5-dichlorophenyl)carbamimidoyl]-4-cyclohexylanilino)methyl]benzoyl]amino]-2-hydroxypropanoic acid.
| Compound Name | (2R)-3-[[4-[(N-[N-cyano-N'-(3,5-dichlorophenyl)carbamimidoyl]-4-cyclohexylanilino)methyl]benzoyl]amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 59123115 |
| Molecular Formula | C31H31Cl2N5O4 |
| Molecular Weight | 608.53 g/mol |
| Exact Mass | 607.18 |
| IUPAC Name | (2R)-3-[[4-[(N-[N-cyano-N'-(3,5-dichlorophenyl)carbamimidoyl]-4-cyclohexylanilino)methyl]benzoyl]amino]-2-hydroxypropanoic acid |
| SMILES | N#CN/C(=N\c1cc(Cl)cc(Cl)c1)N(Cc1ccc(C(=O)NC[C@@H](O)C(=O)O)cc1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C31H31Cl2N5O4/c32-24-14-25(33)16-26(15-24)37-31(36-19-34)38(27-12-10-22(11-13-27)21-4-2-1-3-5-21)18-20-6-8-23(9-7-20)29(40)35-17-28(39)30(41)42/h6-16,21,28,39H,1-5,17-18H2,(H,35,40)(H,36,37)(H,41,42)/t28-/m1/s1 |
| InChIKey | LZGKDZQQTWUABH-MUUNZHRXSA-N |
| XLogP | 5.98 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|