C29H35Cl2N5O3 — CID 59122996
3-[[4-[[(4-tert-butylcyclohexyl)-[N-cyano-N'-(3,5-dichlorophenyl)carbamimidoyl]amino]methyl]benzoyl]amino]propanoic acid (PubChem CID 59122996) has the molecular formula C29H35Cl2N5O3 and a molecular weight of 572.54 g/mol. Its IUPAC name is 3-[[4-[[(4-tert-butylcyclohexyl)-[N-cyano-N'-(3,5-dichlorophenyl)carbamimidoyl]amino]methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[(4-tert-butylcyclohexyl)-[N-cyano-N'-(3,5-dichlorophenyl)carbamimidoyl]amino]methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59122996 |
| Molecular Formula | C29H35Cl2N5O3 |
| Molecular Weight | 572.54 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | 3-[[4-[[(4-tert-butylcyclohexyl)-[N-cyano-N'-(3,5-dichlorophenyl)carbamimidoyl]amino]methyl]benzoyl]amino]propanoic acid |
| SMILES | CC(C)(C)C1CCC(N(Cc2ccc(C(=O)NCCC(=O)O)cc2)/C(=N/c2cc(Cl)cc(Cl)c2)NC#N)CC1 |
| InChI | InChI=1S/C29H35Cl2N5O3/c1-29(2,3)21-8-10-25(11-9-21)36(28(34-18-32)35-24-15-22(30)14-23(31)16-24)17-19-4-6-20(7-5-19)27(39)33-13-12-26(37)38/h4-7,14-16,21,25H,8-13,17H2,1-3H3,(H,33,39)(H,34,35)(H,37,38) |
| InChIKey | SPBXLCMFOCTLLF-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|