C30H34F6IN3O4 — CID 154532665
3-[[4-[[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-[4-(1-iodo-2-methylpropan-2-yl)cyclohexyl]amino]methyl]benzoyl]amino]propanoic acid (PubChem CID 154532665) has the molecular formula C30H34F6IN3O4 and a molecular weight of 741.51 g/mol. Its IUPAC name is 3-[[4-[[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-[4-(1-iodo-2-methylpropan-2-yl)cyclohexyl]amino]methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-[4-(1-iodo-2-methylpropan-2-yl)cyclohexyl]amino]methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 154532665 |
| Molecular Formula | C30H34F6IN3O4 |
| Molecular Weight | 741.51 g/mol |
| Exact Mass | 741.15 |
| IUPAC Name | 3-[[4-[[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-[4-(1-iodo-2-methylpropan-2-yl)cyclohexyl]amino]methyl]benzoyl]amino]propanoic acid |
| SMILES | CC(C)(CI)C1CCC(N(Cc2ccc(C(=O)NCCC(=O)O)cc2)C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C30H34F6IN3O4/c1-28(2,17-37)20-7-9-24(10-8-20)40(16-18-3-5-19(6-4-18)26(43)38-12-11-25(41)42)27(44)39-23-14-21(29(31,32)33)13-22(15-23)30(34,35)36/h3-6,13-15,20,24H,7-12,16-17H2,1-2H3,(H,38,43)(H,39,44)(H,41,42) |
| InChIKey | ZJWIWYNAAOKLQL-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.51 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|