C31H40N4O6 — CID 10231455
3-[[4-[[(4-cyclohexylcyclohexyl)-[(4-methyl-3-nitrophenyl)carbamoyl]amino]methyl]benzoyl]amino]propanoic acid (PubChem CID 10231455) has the molecular formula C31H40N4O6 and a molecular weight of 564.68 g/mol. Its IUPAC name is 3-[[4-[[(4-cyclohexylcyclohexyl)-[(4-methyl-3-nitrophenyl)carbamoyl]amino]methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[(4-cyclohexylcyclohexyl)-[(4-methyl-3-nitrophenyl)carbamoyl]amino]methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10231455 |
| Molecular Formula | C31H40N4O6 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | 3-[[4-[[(4-cyclohexylcyclohexyl)-[(4-methyl-3-nitrophenyl)carbamoyl]amino]methyl]benzoyl]amino]propanoic acid |
| SMILES | Cc1ccc(NC(=O)N(Cc2ccc(C(=O)NCCC(=O)O)cc2)C2CCC(C3CCCCC3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H40N4O6/c1-21-7-14-26(19-28(21)35(40)41)33-31(39)34(27-15-12-24(13-16-27)23-5-3-2-4-6-23)20-22-8-10-25(11-9-22)30(38)32-18-17-29(36)37/h7-11,14,19,23-24,27H,2-6,12-13,15-18,20H2,1H3,(H,32,38)(H,33,39)(H,36,37) |
| InChIKey | QNTJFNPGBLANCH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 141.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|