C38H48N4O6S — CID 67487597
3-[[4-[[(4-cyclohexylcyclohexyl)-[[4-methyl-3-[(2-methylphenyl)sulfamoyl]phenyl]carbamoyl]amino]methyl]benzoyl]amino]propanoic acid (PubChem CID 67487597) has the molecular formula C38H48N4O6S and a molecular weight of 688.89 g/mol. Its IUPAC name is 3-[[4-[[(4-cyclohexylcyclohexyl)-[[4-methyl-3-[(2-methylphenyl)sulfamoyl]phenyl]carbamoyl]amino]methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[(4-cyclohexylcyclohexyl)-[[4-methyl-3-[(2-methylphenyl)sulfamoyl]phenyl]carbamoyl]amino]methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67487597 |
| Molecular Formula | C38H48N4O6S |
| Molecular Weight | 688.89 g/mol |
| Exact Mass | 688.33 |
| IUPAC Name | 3-[[4-[[(4-cyclohexylcyclohexyl)-[[4-methyl-3-[(2-methylphenyl)sulfamoyl]phenyl]carbamoyl]amino]methyl]benzoyl]amino]propanoic acid |
| SMILES | Cc1ccccc1NS(=O)(=O)c1cc(NC(=O)N(Cc2ccc(C(=O)NCCC(=O)O)cc2)C2CCC(C3CCCCC3)CC2)ccc1C |
| InChI | InChI=1S/C38H48N4O6S/c1-26-8-6-7-11-34(26)41-49(47,48)35-24-32(19-12-27(35)2)40-38(46)42(33-20-17-30(18-21-33)29-9-4-3-5-10-29)25-28-13-15-31(16-14-28)37(45)39-23-22-36(43)44/h6-8,11-16,19,24,29-30,33,41H,3-5,9-10,17-18,20-23,25H2,1-2H3,(H,39,45)(H,40,46)(H,43,44) |
| InChIKey | OXXQYEXYSGLWSS-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.89 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |